Clean Chemical MDCP (Mono Dicalcium Phosphate ) 21% for feed grade/phytase enzyme feed additives

 1.Charactor

1) Chemical name:  Mono Dicalcium Phosphate 

2) CAS: 7758-23-8

3) CHEMICAL FORMULA: Ca(H2PO4)2.H2O+CaHPO4.2H20            

4) HS CODE: 28352590000      

5) M. F: CaHPO4

6) M.W:136.06

7) Relative density: 2.32.

2.Properties

Whitish powder; Odorless; Soluble in diluted Hydrochloric Acid, Nitric Acid and Acetic Acid; Slightly soluble in water but insoluble in Ethanol; Stable in air; 

3.Product Application 

1. Dibasic calcium phosphate is the important Mineral Feed Additive nutrition-       based, constant feed additives. Nutrition-based, constant feed additives,             added calcium and phosphorus additives.

2. It accelerated the animals to develop and grow, shortens the period for the         animals to fat up and increases weight

3. Meanwhile it enhances the animal's capability against diseases such as               chondropathy, dysentery and palsy etc. Can also heal the livestock and               poultry's rickets, osteomalacia, anemia, lay soft-shell eggs more symptoms. 

4. Increasing breeding rate and survival rate, can participate in and promote the     metabolism of animals, the composition of hormones, enzymes and                     vitamins.Promote the growth and development.   

 Packing: 25 kg pp bag,25MT/1*20FCL,Or others according to cutomers