Methyltrimethoxysilane content >=99.0%
US $3.50-$4.50
Share on (60793650515):
Ethyl N-cyanoethanimideate 1558-82-3 | |
| Trade name: | CEA, Ethyl N-cyanoethanimideate |
| Product name: | Ethyl N-cyanoethanimideate |
| CAS No.: | 1558-82-3 |
| Molecular weight: | 112.1298 |
| Molecular formula: | C5H8N20 |
| InChI: | InChI=1/C5H8N2O/c1-3-8-5(2)7-4-6/h3H2,1-2H3/b7-5- |
Application
| intermediate of pesticide acetamiprid |
Packing: 200kg per drum , and one 20 feet container can load 80drums (16MT).



New products from manufacturers at wholesale prices